3,5-Dibromo-2-fluoro-4-methylpyridine
CAS No.:
1000340-01-1
M. Wt:
268.909
M. Fa:
C6H4Br2FN
InChI Key:
LAOILGACTMFPSZ-UHFFFAOYSA-N
Appearance:
Yellow Solid
Names and Identifiers of 3,5-Dibromo-2-fluoro-4-methylpyridine
CAS Number |
1000340-01-1 |
|---|---|
MDL Number |
MFCD09864703 |
IUPAC Name |
3,5-dibromo-2-fluoro-4-methylpyridine |
InChI |
InChI=1S/C6H4Br2FN/c1-3-4(7)2-10-6(9)5(3)8/h2H,1H3 |
InChIKey |
LAOILGACTMFPSZ-UHFFFAOYSA-N |
Canonical SMILES |
CC1=C(C(=NC=C1Br)F)Br |
UNSPSC Code |
12352100 |
Physical and chemical properties of 3,5-Dibromo-2-fluoro-4-methylpyridine
Acidity coefficient |
-4.50±0.28(Predicted) |
|---|---|
Boiling Point |
248.5±35.0 °C at 760 mmHg |
Density |
2.0±0.1 g/cm3 |
Exact Mass |
266.869446 |
Flash Point |
104.1±25.9 °C |
Index of Refraction |
1.571 |
LogP |
3.15 |
Molecular Formula |
C6H4Br2FN |
Molecular Weight |
268.909 |
PSA |
12.89000 |
Vapour Pressure |
0.0±0.5 mmHg at 25°C |
Safety Information of 3,5-Dibromo-2-fluoro-4-methylpyridine
Applications of 3,5-Dibromo-2-fluoro-4-methylpyridine
3,5-Dibromo-2-fluoro-4-methylpyridine has several potential applications:
- Pharmaceuticals: It may serve as an intermediate in the synthesis of various pharmaceutical compounds due to its unique structure.
- Agricultural Chemicals: The compound could be explored for use in agrochemicals, particularly as a pesticide or herbicide.
- Material Science: Its properties may be utilized in developing new materials with specific electronic or optical characteristics.
Interaction Studies of 3,5-Dibromo-2-fluoro-4-methylpyridine
Interaction studies involving 3,5-dibromo-2-fluoro-4-methylpyridine focus on its reactivity with biological macromolecules and other small molecules. Investigations typically assess:
- Binding Affinity: How well the compound interacts with target proteins or enzymes.
- Mechanism of Action: Understanding how it affects biological pathways at a molecular level.
- Toxicity Profiles: Evaluating safety and potential side effects when used in biological systems.
Physical sample testing spectrum (NMR) of 3,5-Dibromo-2-fluoro-4-methylpyridine
