3-Chloro-5-tert-butylbenzoic acid
CAS No.:
1000341-32-1
M. Wt:
212.67300
M. Fa:
C11H13ClO2
InChI Key:
XMGFILMCFURRSS-UHFFFAOYSA-N
Names and Identifiers of 3-Chloro-5-tert-butylbenzoic acid
CAS Number |
1000341-32-1 |
|---|---|
MDL Number |
MFCD09880197 |
IUPAC Name |
3-tert-butyl-5-chlorobenzoic acid |
InChI |
InChI=1S/C11H13ClO2/c1-11(2,3)8-4-7(10(13)14)5-9(12)6-8/h4-6H,1-3H3,(H,13,14) |
InChIKey |
XMGFILMCFURRSS-UHFFFAOYSA-N |
Canonical SMILES |
CC(C)(C)C1=CC(=CC(=C1)C(=O)O)Cl |
UNSPSC Code |
12352100 |
Physical and chemical properties of 3-Chloro-5-tert-butylbenzoic acid
Exact Mass |
212.06000 |
|---|---|
H Bond Acceptors |
2 |
H Bond Donors |
1 |
LogP |
3.33570 |
Molecular Formula |
C11H13ClO2 |
Molecular Weight |
212.67300 |
PSA |
37.30000 |
Safety Information of 3-Chloro-5-tert-butylbenzoic acid
Applications of 3-Chloro-5-tert-butylbenzoic acid
3-Chloro-5-tert-butylbenzoic acid finds applications in various fields:
- Organic Synthesis: It serves as an intermediate in the synthesis of pharmaceuticals and agrochemicals.
- Material Science: The compound may be used in the production of polymers and resins due to its chemical stability and reactivity.
- Biological Research: Its potential biological activities make it a subject of interest for drug development and other biomedical applications.
Biological Activity of 3-Chloro-5-tert-butylbenzoic acid
Research into the biological activity of 3-chloro-5-tert-butylbenzoic acid indicates potential antimicrobial properties. Studies suggest that it may interact with cellular targets, inhibiting specific enzymes or receptors, although detailed mechanisms remain under investigation. Its unique structure may contribute to its biological effects, making it a candidate for further pharmacological studies.
