3-Difluoromethyl-2,5-dimethylanisole
Names and Identifiers of 3-Difluoromethyl-2,5-dimethylanisole
CAS Number |
1806277-85-9 |
|---|---|
IUPAC Name |
1-(difluoromethyl)-3-methoxy-2,5-dimethylbenzene |
InChI |
InChI=1S/C10H12F2O/c1-6-4-8(10(11)12)7(2)9(5-6)13-3/h4-5,10H,1-3H3 |
InChIKey |
RUUUOOFHZZVYCA-UHFFFAOYSA-N |
Canonical SMILES |
CC1=CC(=C(C(=C1)OC)C)C(F)F |
Applications of 3-Difluoromethyl-2,5-dimethylanisole
3-Difluoromethyl-2,5-dimethylanisole has potential applications in various domains:
- Medicinal Chemistry: Due to its unique structure and biological activity, it may serve as a lead compound in drug discovery efforts targeting specific diseases.
- Material Science: Its properties may be exploited in creating new materials with enhanced chemical resistance or unique physical characteristics.
- Agricultural Chemistry: Compounds containing difluoromethyl groups are often explored for their efficacy as agrochemicals due to their potential bioactivity against pests or diseases.
Interaction Studies of 3-Difluoromethyl-2,5-dimethylanisole
Studies focusing on the interactions of 3-Difluoromethyl-2,5-dimethylanisole with biological macromolecules are crucial for understanding its mechanism of action. These interactions may involve binding to proteins or nucleic acids, influencing biochemical pathways relevant to therapeutic outcomes. Research methodologies include molecular docking studies and enzyme inhibition assays to elucidate these interactions further.
Biological Activity of 3-Difluoromethyl-2,5-dimethylanisole
Research into the biological activity of 3-Difluoromethyl-2,5-dimethylanisole is ongoing. Preliminary studies indicate that compounds with difluoromethyl groups can exhibit enhanced biological activity due to their ability to interact with specific enzymes and receptors. The presence of fluorine atoms often increases lipophilicity and metabolic stability, making such compounds attractive candidates for drug development.