4-Bromothiophene-3-carboxamide
Names and Identifiers of 4-Bromothiophene-3-carboxamide
CAS Number |
100245-61-2 |
|---|---|
EC Number |
664-259-7 |
MDL Number |
MFCD17171292 |
IUPAC Name |
4-bromothiophene-3-carboxamide |
InChI |
InChI=1S/C5H4BrNOS/c6-4-2-9-1-3(4)5(7)8/h1-2H,(H2,7,8) |
InChIKey |
BMZBDWPOBVGKSU-UHFFFAOYSA-N |
Canonical SMILES |
C1=C(C(=CS1)Br)C(=O)N |
UNSPSC Code |
12352100 |
Physical and chemical properties of 4-Bromothiophene-3-carboxamide
Exact Mass |
204.92000 |
|---|---|
LogP |
2.30980 |
Melting Point |
150-155°C |
Molecular Formula |
C5H4BrNOS |
Molecular Weight |
206.06000 |
PSA |
71.33000 |
Storage condition |
2-8°C(protect from light) |
Safety Information of 4-Bromothiophene-3-carboxamide
Applications of 4-Bromothiophene-3-carboxamide
4-Bromothiophene-3-carboxamide has several applications:
- Pharmaceuticals: It is being investigated for its potential as an active pharmaceutical ingredient due to its biological properties.
- Materials Science: Its unique electronic properties make it suitable for use in organic electronics, such as organic light-emitting diodes (OLEDs) and organic photovoltaics.
- Chemical Intermediates: It serves as a building block for synthesizing more complex organic molecules.
Interaction Studies of 4-Bromothiophene-3-carboxamide
Interaction studies involving 4-Bromothiophene-3-carboxamide focus on its reactivity with various biological targets. Preliminary research suggests that it may interact with proteins involved in cellular signaling pathways, potentially influencing processes such as cell proliferation and apoptosis. Further studies are needed to elucidate these interactions and their implications for therapeutic applications.
Biological Activity of 4-Bromothiophene-3-carboxamide
The biological activity of 4-Bromothiophene-3-carboxamide has been explored in various studies. Thiophene derivatives are known for their antimicrobial and antifungal properties, and compounds similar to 4-bromothiophene-3-carboxamide have shown promise as potential drug candidates in treating infections. Additionally, some studies indicate that thiophene-based compounds exhibit anti-inflammatory and anticancer activities, although specific data on 4-bromothiophene-3-carboxamide remains limited.
Physical sample testing spectrum (NMR) of 4-Bromothiophene-3-carboxamide
