4-CHLORO-5-IODO (1H)INDAZOLE
CAS No.:
1000342-37-9
M. Wt:
278.478
M. Fa:
C7H4ClIN2
InChI Key:
YJBOYUUJTXXCHY-UHFFFAOYSA-N
Appearance:
Yellow Solid
Names and Identifiers of 4-CHLORO-5-IODO (1H)INDAZOLE
CAS Number |
1000342-37-9 |
|---|---|
MDL Number |
MFCD09880012 |
IUPAC Name |
4-chloro-5-iodo-1H-indazole |
InChI |
InChI=1S/C7H4ClIN2/c8-7-4-3-10-11-6(4)2-1-5(7)9/h1-3H,(H,10,11) |
InChIKey |
YJBOYUUJTXXCHY-UHFFFAOYSA-N |
Canonical SMILES |
ClC1=C(I)C=CC2=C1C=NN2 |
UNSPSC Code |
12352100 |
Physical and chemical properties of 4-CHLORO-5-IODO (1H)INDAZOLE
Acidity coefficient |
11.69±0.40(Predicted) |
|---|---|
Boiling Point |
394.2±22.0 °C at 760 mmHg |
Density |
2.2±0.1 g/cm3 |
Exact Mass |
277.910767 |
Flash Point |
192.2±22.3 °C |
H Bond Acceptors |
1 |
H Bond Donors |
1 |
Index of Refraction |
1.785 |
LogP |
3.71 |
Molecular Formula |
C7H4ClIN2 |
Molecular Weight |
278.478 |
PSA |
28.68000 |
Vapour Pressure |
0.0±0.9 mmHg at 25°C |
Safety Information of 4-CHLORO-5-IODO (1H)INDAZOLE
Applications of 4-CHLORO-5-IODO (1H)INDAZOLE
4-Chloro-5-iodo-1H-indazole has potential applications in various fields:
- Pharmaceutical Development: Its unique structure may lead to novel therapeutic agents targeting cancer or infectious diseases.
- Chemical Research: Used as a building block in synthetic organic chemistry for developing more complex molecules.
- Material Science: Potential applications in creating advanced materials due to its electronic properties .
Interaction Studies of 4-CHLORO-5-IODO (1H)INDAZOLE
Interaction studies of 4-chloro-5-iodo-1H-indazole with biological targets are essential for understanding its pharmacodynamics:
- Protein Binding Studies: Investigating how this compound interacts with proteins can provide insights into its mechanism of action.
- Cellular Uptake Studies: Understanding how effectively this compound penetrates cellular membranes could inform its bioavailability and therapeutic efficacy.
Physical sample testing spectrum (NMR) of 4-CHLORO-5-IODO (1H)INDAZOLE
