5-(Azepan-1-yl)-2-nitrobenzoic acid
Names and Identifiers of 5-(Azepan-1-yl)-2-nitrobenzoic acid
CAS Number |
1000018-50-7 |
|---|---|
IUPAC Name |
5-(azepan-1-yl)-2-nitrobenzoic acid |
InChI |
InChI=1S/C13H16N2O4/c16-13(17)11-9-10(5-6-12(11)15(18)19)14-7-3-1-2-4-8-14/h5-6,9H,1-4,7-8H2,(H,16,17) |
InChIKey |
PWQLQASFACMTGY-UHFFFAOYSA-N |
Canonical SMILES |
C1CCCN(CC1)C2=CC(=C(C=C2)[N+](=O)[O-])C(=O)O |
Physical and chemical properties of 5-(Azepan-1-yl)-2-nitrobenzoic acid
Exact Mass |
264.11100 |
|---|---|
LogP |
3.26160 |
Molecular Formula |
C13H16N2O4 |
Molecular Weight |
264.27700 |
PSA |
86.36000 |
Applications of 5-(Azepan-1-yl)-2-nitrobenzoic acid
5-(Azepan-1-yl)-2-nitrobenzoic acid has potential applications in:
- Pharmaceutical Development: As a lead compound for designing new drugs targeting neurodegenerative diseases.
- Chemical Probes: In research settings, it can serve as a chemical probe to study enzyme mechanisms or cellular pathways.
- Agricultural Chemistry: The compound may find utility in developing agrochemicals due to its biological activity.
Interaction Studies of 5-(Azepan-1-yl)-2-nitrobenzoic acid
Interaction studies have shown that 5-(Azepan-1-yl)-2-nitrobenzoic acid interacts with various biological targets. Its inhibition of acetylcholinesterase suggests potential interactions with other neurotransmitter systems. Additionally, studies indicate that the azepane ring contributes to binding affinity and specificity towards these targets.
Biological Activity of 5-(Azepan-1-yl)-2-nitrobenzoic acid
Research indicates that 5-(Azepan-1-yl)-2-nitrobenzoic acid exhibits significant biological activity, particularly as an inhibitor of acetylcholinesterase. This enzyme plays a critical role in neurotransmission, and its inhibition can have therapeutic implications for conditions such as Alzheimer's disease and other neurodegenerative disorders. Additionally, the compound may possess anti-inflammatory properties, making it a candidate for further pharmacological studies.