5-Chloro-2-iodobenzaldehyde
CAS No.:
1001334-22-0
M. Wt:
266.46400
M. Fa:
C7H4ClIO
InChI Key:
WJJNLCSRPMRUCY-UHFFFAOYSA-N
Names and Identifiers of 5-Chloro-2-iodobenzaldehyde
CAS Number |
1001334-22-0 |
|---|---|
EC Number |
862-759-1 |
IUPAC Name |
5-chloro-2-iodobenzaldehyde |
InChI |
InChI=1S/C7H4ClIO/c8-6-1-2-7(9)5(3-6)4-10/h1-4H |
InChIKey |
WJJNLCSRPMRUCY-UHFFFAOYSA-N |
Canonical SMILES |
C1=CC(=C(C=C1Cl)C=O)I |
Physical and chemical properties of 5-Chloro-2-iodobenzaldehyde
Exact Mass |
265.90000 |
|---|---|
LogP |
2.75710 |
Molecular Formula |
C7H4ClIO |
Molecular Weight |
266.46400 |
PSA |
17.07000 |
Safety Information of 5-Chloro-2-iodobenzaldehyde
Applications of 5-Chloro-2-iodobenzaldehyde
5-Chloro-2-iodobenzaldehyde serves multiple applications in various fields:
- Organic Synthesis: It is used as an intermediate in the synthesis of more complex organic molecules.
- Pharmaceutical Development: Its unique structure makes it a candidate for developing new pharmaceuticals, particularly in targeting diseases where halogenated compounds have shown efficacy.
- Material Science: The compound may find applications in developing novel materials due to its distinctive electronic properties arising from its halogen substituents.
Interaction Studies of 5-Chloro-2-iodobenzaldehyde
Interaction studies involving 5-Chloro-2-iodobenzaldehyde focus on understanding how this compound interacts with biological macromolecules such as proteins and nucleic acids. These interactions are crucial for assessing its potential therapeutic effects and toxicity. While specific interaction studies remain sparse, compounds with similar structures have demonstrated significant interactions with enzymes and receptors, suggesting that 5-Chloro-2-iodobenzaldehyde may exhibit comparable behavior.
Physical sample testing spectrum (NMR) of 5-Chloro-2-iodobenzaldehyde
Cas:13421-00-6
