5-Iodo-2-phenylthiazole
CAS No.:
1000029-07-1
M. Wt:
287.12000
M. Fa:
C9H6INS
InChI Key:
KYBZIVOEYAIDAI-UHFFFAOYSA-N
Names and Identifiers of 5-Iodo-2-phenylthiazole
CAS Number |
1000029-07-1 |
|---|---|
IUPAC Name |
5-iodo-2-phenyl-1,3-thiazole |
InChI |
InChI=1S/C9H6INS/c10-8-6-11-9(12-8)7-4-2-1-3-5-7/h1-6H |
InChIKey |
KYBZIVOEYAIDAI-UHFFFAOYSA-N |
Canonical SMILES |
C1=CC=C(C=C1)C2=NC=C(S2)I |
Physical and chemical properties of 5-Iodo-2-phenylthiazole
Exact Mass |
286.92700 |
|---|---|
LogP |
3.41470 |
Molecular Formula |
C9H6INS |
Molecular Weight |
287.12000 |
PSA |
41.13000 |
Applications of 5-Iodo-2-phenylthiazole
5-Iodo-2-phenylthiazole finds applications in various fields:
- Pharmaceuticals: It serves as a building block for synthesizing bioactive compounds with potential therapeutic effects.
- Material Science: Its derivatives may be used in developing novel materials with specific electronic or optical properties.
The compound's unique properties make it valuable for both medicinal and material applications.
Interaction Studies of 5-Iodo-2-phenylthiazole
Studies on interaction mechanisms involving 5-Iodo-2-phenylthiazole focus on its binding affinities with biological targets. For instance:
- Enzyme Inhibition Studies: Investigations into how this compound interacts with specific enzymes can reveal its potential as a drug candidate.
- Receptor Binding Affinity: Understanding how it binds to various receptors can help elucidate its pharmacological profile.
Such studies are essential for optimizing its use in therapeutic contexts .