6-BROMO-3-CYANO-4-FLUORO 1H-INDAZOLE
CAS No.:
1000340-94-2
M. Wt:
240.032
M. Fa:
C8H3BrFN3
InChI Key:
-
Names and Identifiers of 6-BROMO-3-CYANO-4-FLUORO 1H-INDAZOLE
CAS Number |
1000340-94-2 |
|---|---|
IUPAC Name |
6-bromanyl-4-fluoranyl-1H-indazole-3-carbonitrile |
Canonical SMILES |
C1=C(C=C(C2=C1NN=C2C#N)F)Br |
Physical and chemical properties of 6-BROMO-3-CYANO-4-FLUORO 1H-INDAZOLE
Boiling Point |
421.8±40.0 °C at 760 mmHg |
|---|---|
Density |
1.9±0.1 g/cm3 |
Exact Mass |
238.949432 |
Flash Point |
208.9±27.3 °C |
Index of Refraction |
1.705 |
LogP |
2.24 |
Molecular Formula |
C8H3BrFN3 |
Molecular Weight |
240.032 |
PSA |
52.47000 |
Vapour Pressure |
0.0±1.0 mmHg at 25°C |
Applications of 6-BROMO-3-CYANO-4-FLUORO 1H-INDAZOLE
6-bromo-4-fluoro-1H-indazole-3-carbonitrile may find applications in various fields:
- Pharmaceuticals: As a potential lead compound for drug development targeting inflammatory diseases or cancers.
- Agriculture: Its derivatives could be explored for use as agrochemicals or pesticides due to their biological activity.
- Material Science: The compound may serve as a building block in synthesizing novel materials with specific electronic or optical properties.
Interaction Studies of 6-BROMO-3-CYANO-4-FLUORO 1H-INDAZOLE
Interaction studies involving 6-bromo-4-fluoro-1H-indazole-3-carbonitrile are crucial for understanding its potential therapeutic effects. These studies typically focus on:
- Binding affinity: Evaluating how effectively the compound binds to specific proteins or enzymes.
- Mechanism of action: Investigating how this compound influences biological pathways at the molecular level.
Such studies are essential for elucidating its pharmacodynamics and potential side effects.