6-Bromo-5-chloropyridin-2-amine
Names and Identifiers of 6-Bromo-5-chloropyridin-2-amine
CAS Number |
1004294-58-9 |
|---|---|
MDL Number |
MFCD16556292 |
IUPAC Name |
6-bromo-5-chloropyridin-2-amine |
InChI |
InChI=1S/C5H4BrClN2/c6-5-3(7)1-2-4(8)9-5/h1-2H,(H2,8,9) |
InChIKey |
YRNODZRPIGNGMY-UHFFFAOYSA-N |
Canonical SMILES |
C1=CC(=NC(=C1Cl)Br)N |
UNSPSC Code |
12352100 |
Physical and chemical properties of 6-Bromo-5-chloropyridin-2-amine
Acidity coefficient |
1.26±0.10(Predicted) |
|---|---|
Boiling Point |
304.2±37.0 °C(Predicted) |
Density |
1.834 |
Exact Mass |
205.92500 |
LogP |
2.00980 |
Molecular Formula |
C5H4BrClN2 |
Molecular Weight |
207.45600 |
PSA |
39.64000 |
Storage condition |
2-8°C |
Safety Information of 6-Bromo-5-chloropyridin-2-amine
Applications of 6-Bromo-5-chloropyridin-2-amine
6-Bromo-5-chloropyridin-2-amine finds applications in various fields:
- Pharmaceuticals: Used as an intermediate in the synthesis of drugs targeting specific biological pathways.
- Agrochemicals: Potentially utilized in developing pesticides or herbicides due to its biological activity.
- Material Science: May serve as a precursor for functional materials in organic electronics or sensors.
Its unique structure allows it to interact with various biological targets, making it valuable in drug discovery.
Interaction Studies of 6-Bromo-5-chloropyridin-2-amine
Studies on the interactions of 6-Bromo-5-chloropyridin-2-amine with biological systems reveal its role as a cytochrome P450 enzyme inhibitor. This interaction is crucial for understanding its effects on drug metabolism and potential side effects when used in therapeutic contexts. Further exploration into its binding affinities and mechanisms could provide insights into optimizing its use in medicinal applications.
Biological Activity of 6-Bromo-5-chloropyridin-2-amine
6-Bromo-5-chloropyridin-2-amine exhibits notable biological activities, particularly as an inhibitor of cytochrome P450 enzymes, specifically CYP1A2. This inhibition suggests potential applications in drug metabolism and pharmacokinetics. Additionally, it has been reported to have antimicrobial properties, making it a candidate for further exploration in medicinal chemistry.
Physical sample testing spectrum (NMR) of 6-Bromo-5-chloropyridin-2-amine
Cas:19798-81-3
Cas:1004294-57-8