7-bromo-4-fluoro-1H-indazole
Names and Identifiers of 7-bromo-4-fluoro-1H-indazole
CAS Number |
1000341-72-9 |
|---|---|
MDL Number |
MFCD09749914 |
IUPAC Name |
7-bromo-4-fluoro-1H-indazole |
InChI |
InChI=1S/C7H4BrFN2/c8-5-1-2-6(9)4-3-10-11-7(4)5/h1-3H,(H,10,11) |
InChIKey |
DMELXNIJOPEOFT-UHFFFAOYSA-N |
Canonical SMILES |
C1=CC(=C2C(=C1F)C=NN2)Br |
UNSPSC Code |
12352100 |
Physical and chemical properties of 7-bromo-4-fluoro-1H-indazole
Boiling Point |
330.3±22.0 °C at 760 mmHg |
|---|---|
Density |
1.9±0.1 g/cm3 |
Exact Mass |
213.954178 |
Flash Point |
153.6±22.3 °C |
Index of Refraction |
1.693 |
LogP |
2.58 |
Molecular Formula |
C7H4BrFN2 |
Molecular Weight |
215.023 |
PSA |
28.68000 |
Vapour Pressure |
0.0±0.7 mmHg at 25°C |
Safety Information of 7-bromo-4-fluoro-1H-indazole
Applications of 7-bromo-4-fluoro-1H-indazole
7-bromo-4-fluoro-1H-indazole finds applications primarily in medicinal chemistry due to its biological activities. It serves as a lead compound for developing new pharmaceuticals targeting various diseases, particularly in oncology and neurology. Additionally, its unique chemical properties make it valuable in material science for synthesizing novel materials with specific electronic or optical characteristics.
Interaction Studies of 7-bromo-4-fluoro-1H-indazole
Interaction studies involving 7-bromo-4-fluoro-1H-indazole focus on its biochemical pathways and potential targets within biological systems. Research indicates that this compound can interact with various enzymes and receptors, influencing cellular processes related to inflammation, cancer progression, and neurotransmitter activity. Understanding these interactions is crucial for elucidating its therapeutic potential and optimizing its efficacy.
Biological Activity of 7-bromo-4-fluoro-1H-indazole
7-bromo-4-fluoro-1H-indazole has been investigated for its potential biological activities, particularly in pharmacology. Compounds containing the indazole moiety have shown a broad spectrum of biological effects, including:
- Antihypertensive: Potential in managing high blood pressure.
- Anticancer: Activity against various cancer cell lines.
- Antidepressant: Effects that may alleviate symptoms of depression.
- Anti-inflammatory: Capable of reducing inflammation.
- Antibacterial: Exhibits properties against bacterial infections.
The mode of action is believed to involve interactions with specific biochemical pathways, influenced by the electron-deficient nature of the fluorine substituent, which can modulate the energy levels within the molecule.
Physical sample testing spectrum (NMR) of 7-bromo-4-fluoro-1H-indazole
