7-chloro-4-fluoro-1H-indazole
Names and Identifiers of 7-chloro-4-fluoro-1H-indazole
CAS Number |
1000341-70-7 |
|---|---|
MDL Number |
MFCD35097955 |
IUPAC Name |
7-chloro-4-fluoro-1H-indazole |
InChI |
InChI=1S/C7H4ClFN2/c8-5-1-2-6(9)4-3-10-11-7(4)5/h1-3H,(H,10,11) |
InChIKey |
PBIXHDNEONVWJP-UHFFFAOYSA-N |
Canonical SMILES |
C1=CC(=C2C(=C1F)C=NN2)Cl |
UNSPSC Code |
12352100 |
Physical and chemical properties of 7-chloro-4-fluoro-1H-indazole
Boiling Point |
311.6±22.0 °C at 760 mmHg |
|---|---|
Density |
1.5±0.1 g/cm3 |
Exact Mass |
170.004700 |
Flash Point |
142.3±22.3 °C |
H Bond Acceptors |
1 |
H Bond Donors |
1 |
Index of Refraction |
1.669 |
LogP |
2.42 |
Molecular Formula |
C7H4ClFN2 |
Molecular Weight |
170.572 |
PSA |
28.68000 |
Vapour Pressure |
0.0±0.6 mmHg at 25°C |
Safety Information of 7-chloro-4-fluoro-1H-indazole
Applications of 7-chloro-4-fluoro-1H-indazole
7-Chloro-4-fluoro-1H-indazole has potential applications in:
- Pharmaceutical Development: Due to its biological activity, it may serve as a lead compound for developing new antimicrobial agents.
- Research: Its unique structural features make it valuable in studies exploring enzyme inhibition and drug design.
Interaction Studies of 7-chloro-4-fluoro-1H-indazole
Interaction studies have demonstrated that 7-chloro-4-fluoro-1H-indazole can bind effectively to the active sites of various enzymes, leading to significant changes in their activity. For example, its role as an inhibitor of lactoperoxidase highlights its potential as a therapeutic agent against microbial infections.
Biological Activity of 7-chloro-4-fluoro-1H-indazole
Studies have shown that 7-chloro-4-fluoro-1H-indazole exhibits significant biological activity, particularly as an inhibitor of lactoperoxidase, an enzyme with antimicrobial properties. Its inhibitory effects on lactoperoxidase indicate potential applications in treating infections and other microbial-related conditions. The compound's interaction with specific biomolecules can lead to enzyme inhibition, affecting various cellular signaling pathways.
Physical sample testing spectrum (NMR) of 7-chloro-4-fluoro-1H-indazole
