Diethyl 3-hydroxycyclobutane-1,1-dicarboxylate
CAS No.:
99974-66-0
M. Wt:
216.23100
M. Fa:
C10H16O5
InChI Key:
HCVGFHCQRXXAGH-UHFFFAOYSA-N
Appearance:
Pale-yellow Liquid
Names and Identifiers of 99974-66-0
CAS Number |
99974-66-0 |
|---|---|
MDL Number |
MFCD11878435 |
IUPAC Name |
diethyl 3-hydroxycyclobutane-1,1-dicarboxylate |
InChI |
InChI=1S/C10H16O5/c1-3-14-8(12)10(5-7(11)6-10)9(13)15-4-2/h7,11H,3-6H2,1-2H3 |
InChIKey |
HCVGFHCQRXXAGH-UHFFFAOYSA-N |
Canonical SMILES |
CCOC(=O)C1(CC(C1)O)C(=O)OCC |
UNSPSC Code |
12352100 |
Physical and chemical properties of 99974-66-0
Acidity coefficient |
14.23±0.40(Predicted) |
|---|---|
Boiling Point |
272.939ºC at 760 mmHg |
Density |
1.238g/cm3 |
Exact Mass |
216.10000 |
Flash Point |
97.585ºC |
Index of Refraction |
1.497 |
LogP |
0.25370 |
Molecular Formula |
C10H16O5 |
Molecular Weight |
216.23100 |
PSA |
72.83000 |
Storage condition |
2-8°C |
Safety Information of 99974-66-0
Applications of 99974-66-0
Diethyl 3-hydroxycyclobutane-1,1-dicarboxylate has potential applications in various fields:
- Organic Synthesis: As a building block for synthesizing more complex molecules.
- Pharmaceuticals: Potentially useful in drug development due to its unique structural features.
- Material Science: Could be explored for creating new materials with specific properties.
Research into its applications is ongoing, and further studies may reveal additional uses.
Interaction Studies of 99974-66-0
Interaction studies involving diethyl 3-hydroxycyclobutane-1,1-dicarboxylate are essential for understanding its behavior in biological systems and potential interactions with other compounds. Investigating how this compound interacts with enzymes or receptors could provide insights into its biological activity and therapeutic potential. Such studies typically involve:
- Binding assays: To determine affinity towards biological targets.
- Metabolic studies: To assess how the compound is processed in biological systems.
These interactions are crucial for evaluating safety and efficacy in potential applications.
Physical sample testing spectrum (NMR) of 99974-66-0
