Fmoc-Gly-Gly-Gly-Gly
Names and Identifiers of Fmoc-Gly-Gly-Gly-Gly
CAS Number |
1001202-16-9 |
|---|---|
IUPAC Name |
2-[[2-[[2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]acetyl]amino]acetyl]amino]acetic acid |
InChI |
InChI=1S/C23H24N4O7/c28-19(24-10-20(29)26-12-22(31)32)9-25-21(30)11-27-23(33)34-13-18-16-7-3-1-5-14(16)15-6-2-4-8-17(15)18/h1-8,18H,9-13H2,(H,24,28)(H,25,30)(H,26,29)(H,27,33)(H,31,32) |
InChIKey |
ZJOXACLWNQEOCP-UHFFFAOYSA-N |
Canonical SMILES |
C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCC(=O)NCC(=O)NCC(=O)NCC(=O)O |
Physical and chemical properties of Fmoc-Gly-Gly-Gly-Gly
Acidity coefficient |
3.32±0.10(Predicted) |
|---|---|
Boiling Point |
930.4±65.0°C |
Density |
1.367 |
Exact Mass |
468.16400 |
LogP |
1.52190 |
Molecular Formula |
C23H24N4O7 |
Molecular Weight |
468.45900 |
PSA |
162.93000 |
Storage condition |
2-8°C |
Applications of Fmoc-Gly-Gly-Gly-Gly
Fmoc-Gly-Gly-Gly-Gly finds applications across various domains:
- Peptide Synthesis: It serves as a building block in the synthesis of more complex peptides.
- Biotechnology: Used in research related to drug delivery systems and biomolecular interactions.
- Proteomics: Important for studying protein structures and functions due to its stability and compatibility with various analytical techniques.
Interaction Studies of Fmoc-Gly-Gly-Gly-Gly
Studies involving Fmoc-Gly-Gly-Gly-Gly have focused on its interactions with biological receptors and proteins. For instance, its role in modulating oxytocin receptor activity highlights its potential in understanding hormonal signaling pathways. Additionally, it may be explored for its interactions with other biomolecules in drug design and development.
Biological Activity of Fmoc-Gly-Gly-Gly-Gly
Research indicates that Fmoc-Gly-Gly-Gly-Gly has notable biological activities. It has been used to study the binding affinity of oxytocin to its receptor, which plays a crucial role in various physiological processes such as uterine contractions during labor. Additionally, the compound shows potential in drug delivery systems due to its ability to form stable complexes with therapeutic agents.
Physical sample testing spectrum (NMR) of Fmoc-Gly-Gly-Gly-Gly
Cas:28920-43-6
Cas:556-33-2
