Methyl 3-aminoquinoline-7-carboxylate
Names and Identifiers of Methyl 3-aminoquinoline-7-carboxylate
CAS Number |
1822679-71-9 |
|---|---|
MDL Number |
MFCD28133487 |
IUPAC Name |
methyl 3-aminoquinoline-7-carboxylate |
InChI |
InChI=1S/C11H10N2O2/c1-15-11(14)8-3-2-7-4-9(12)6-13-10(7)5-8/h2-6H,12H2,1H3 |
InChIKey |
YTYJLWOULIXOCN-UHFFFAOYSA-N |
Canonical SMILES |
COC(=O)C1=CC2=NC=C(C=C2C=C1)N |
UNSPSC Code |
12352100 |
Physical and chemical properties of Methyl 3-aminoquinoline-7-carboxylate
Boiling Point |
381.7±22.0 °C at 760 mmHg |
|---|---|
Density |
1.3±0.1 g/cm3 |
Exact Mass |
202.074234 |
Flash Point |
184.6±22.3 °C |
Index of Refraction |
1.664 |
LogP |
1.47 |
Molecular Formula |
C11H10N2O2 |
Molecular Weight |
202.209 |
Vapour Pressure |
0.0±0.9 mmHg at 25°C |
Safety Information of Methyl 3-aminoquinoline-7-carboxylate
Applications of Methyl 3-aminoquinoline-7-carboxylate
Methyl 3-aminoquinoline-7-carboxylate has potential applications in several fields:
- Pharmaceuticals: It serves as an intermediate in the synthesis of bioactive compounds.
- Chemical Research: Utilized in studies involving quinoline derivatives for their pharmacological properties.
- Material Science: Investigated for its properties in developing new materials with specific functionalities.
Interaction Studies of Methyl 3-aminoquinoline-7-carboxylate
Studies on interaction profiles suggest that methyl 3-aminoquinoline-7-carboxylate interacts with various biological targets, including enzymes and receptors. These interactions are crucial for understanding its mechanism of action and potential therapeutic uses. For example, research indicates that similar compounds can inhibit certain kinases involved in cancer progression, making them candidates for further development as anti-cancer agents.
Biological Activity of Methyl 3-aminoquinoline-7-carboxylate
Research indicates that compounds related to methyl 3-aminoquinoline-7-carboxylate exhibit significant biological activities, particularly in pharmacology. They have been studied for their potential anti-cancer properties, antimicrobial effects, and ability to inhibit specific enzymes related to disease processes. For instance, derivatives of quinoline structures are known for their activity against various pathogens and cancer cells.