Methyl 3-chloro-4-ethylbenzoate
CAS No.:
1081551-72-5
M. Wt:
198.64600
M. Fa:
C10H11ClO2
InChI Key:
XWEXJELGUOETAS-UHFFFAOYSA-N
Names and Identifiers of Methyl 3-chloro-4-ethylbenzoate
CAS Number |
1081551-72-5 |
|---|---|
IUPAC Name |
methyl 3-chloro-4-ethylbenzoate |
InChI |
InChI=1S/C10H11ClO2/c1-3-7-4-5-8(6-9(7)11)10(12)13-2/h4-6H,3H2,1-2H3 |
InChIKey |
XWEXJELGUOETAS-UHFFFAOYSA-N |
Canonical SMILES |
CCC1=C(C=C(C=C1)C(=O)OC)Cl |
Physical and chemical properties of Methyl 3-chloro-4-ethylbenzoate
Exact Mass |
198.04500 |
|---|---|
LogP |
2.68900 |
Molecular Formula |
C10H11ClO2 |
Molecular Weight |
198.64600 |
PSA |
26.30000 |
Applications of Methyl 3-chloro-4-ethylbenzoate
Methyl 3-chloro-4-ethylbenzoate finds applications across various fields:
- Organic Synthesis: Used as an intermediate in the synthesis of more complex organic molecules.
- Pharmaceuticals: Investigated for potential therapeutic properties and as a precursor for drug candidates.
- Chemical Research: Utilized in studies involving enzyme-catalyzed reactions and biochemical assays.
Biological Activity of Methyl 3-chloro-4-ethylbenzoate
Methyl 3-chloro-4-ethylbenzoate has been studied for its biological activity, particularly its interaction with various enzymes and receptors. Similar compounds are known to participate in biochemical pathways that involve the degradation of food substances and energy production. The compound's mode of action is thought to involve its electrophilic nature, allowing it to interact with nucleophilic sites on biological molecules.