Methyl 3-fluoro-2-vinylisonicotinat
CAS No.:
1379375-19-5
M. Wt:
181.16
M. Fa:
C9H8FNO2
InChI Key:
XMVFQPJOJINSAY-UHFFFAOYSA-N
Names and Identifiers of Methyl 3-fluoro-2-vinylisonicotinat
CAS Number |
1379375-19-5 |
|---|---|
IUPAC Name |
methyl 2-ethenyl-3-fluoropyridine-4-carboxylate |
InChI |
InChI=1S/C9H8FNO2/c1-3-7-8(10)6(4-5-11-7)9(12)13-2/h3-5H,1H2,2H3 |
InChIKey |
XMVFQPJOJINSAY-UHFFFAOYSA-N |
Canonical SMILES |
COC(=O)C1=C(C(=NC=C1)C=C)F |
Physical and chemical properties of Methyl 3-fluoro-2-vinylisonicotinat
Molecular Formula |
C9H8FNO2 |
|---|---|
Molecular Weight |
181.16 |
Applications of Methyl 3-fluoro-2-vinylisonicotinat
Methyl 3-fluoro-2-vinylisonicotinate has potential applications in various fields:
- Pharmaceutical Development: Its unique structure may lead to the discovery of new drugs, particularly in treating infectious diseases or cancer.
- Material Science: Due to its vinyl functionality, it could be utilized in polymer chemistry for synthesizing novel materials with specific properties.
- Agricultural Chemistry: Compounds with similar structures have been investigated for use as agrochemicals, suggesting potential applications in pest control.
Interaction Studies of Methyl 3-fluoro-2-vinylisonicotinat
Interaction studies involving methyl 3-fluoro-2-vinylisonicotinate could provide insights into its binding affinities with biological targets. Understanding these interactions is crucial for assessing its pharmacological potential and toxicity. Preliminary studies could focus on:
- Protein Binding Assays: Evaluating how well the compound binds to target proteins associated with disease pathways.
- Cellular Uptake Studies: Investigating how effectively the compound enters cells and its subsequent effects on cellular function.
Such studies are essential for determining the viability of this compound as a therapeutic agent.
Cas:628691-93-0
