N'-cyanofuran-2-carboximidamide
CAS No.:
1211577-48-8
M. Wt:
-
M. Fa:
-
InChI Key:
NWORGVPEQMZWGD-UHFFFAOYSA-N
Names and Identifiers of N'-cyanofuran-2-carboximidamide
CAS Number |
1211577-48-8 |
|---|---|
IUPAC Name |
N'-cyanofuran-2-carboximidamide |
InChI |
InChI=1S/C6H5N3O/c7-4-9-6(8)5-2-1-3-10-5/h1-3H,(H2,8,9) |
InChIKey |
NWORGVPEQMZWGD-UHFFFAOYSA-N |
Canonical SMILES |
C1=COC(=C1)C(=NC#N)N |
Physical and chemical properties of N'-cyanofuran-2-carboximidamide
Acidity coefficient |
-0.63±0.50(Predicted) |
|---|---|
Boiling Point |
194.8±32.0 °C(Predicted) |
Density |
1.28±0.1 g/cm3(Predicted) |
Applications of N'-cyanofuran-2-carboximidamide
N'-cyanofuran-2-carboximidamide has potential applications in various domains:
- Pharmaceuticals: Its derivatives are explored for use in drug development due to their biological activity.
- Agriculture: Compounds with similar structures may find use as agrochemicals or pesticides.
- Material Science: Investigated for incorporation into polymers or other materials due to their unique chemical properties.
Interaction Studies of N'-cyanofuran-2-carboximidamide
Interaction studies involving N'-cyanofuran-2-carboximidamide focus on its binding affinity with biological targets:
- Protein Binding Studies: Assessing how this compound interacts with proteins can provide insights into its mechanism of action.
- Docking Studies: Computational models are used to predict how N'-cyanofuran-2-carboximidamide binds to various enzymes or receptors, aiding in drug design efforts.
Biological Activity of N'-cyanofuran-2-carboximidamide
Research indicates that compounds related to N'-cyanofuran-2-carboximidamide exhibit significant biological activities. These may include:
- Antimicrobial Properties: Certain derivatives have shown activity against various bacterial strains.
- Anticancer Activity: Some studies suggest potential anticancer properties, although further research is needed to understand mechanisms and efficacy fully.
- Enzyme Inhibition: Compounds with similar structures have been identified as inhibitors of specific enzymes, which could be leveraged in therapeutic applications.
Cas:617-90-3
