N-(1,4-dioxonaphthalen-2-yl)benzamide
Names and Identifiers of N-(1,4-dioxonaphthalen-2-yl)benzamide
CAS Number |
65240-86-0 |
|---|---|
IUPAC Name |
N-(1,4-dioxonaphthalen-2-yl)benzamide |
InChI |
InChI=1S/C17H11NO3/c19-15-10-14(16(20)13-9-5-4-8-12(13)15)18-17(21)11-6-2-1-3-7-11/h1-10H,(H,18,21) |
InChIKey |
BIVQBWSIGJFXLF-UHFFFAOYSA-N |
Canonical SMILES |
C1=CC=C(C=C1)C(=O)NC2=CC(=O)C3=CC=CC=C3C2=O |
Physical and chemical properties of N-(1,4-dioxonaphthalen-2-yl)benzamide
Boiling Point |
517.5±50.0 °C at 760 mmHg |
|---|---|
Density |
1.4±0.1 g/cm3 |
Exact Mass |
277.073883 |
Flash Point |
208.2±30.3 °C |
Index of Refraction |
1.667 |
LogP |
2.09 |
Melting Point |
134-136°C |
Molecular Formula |
C17H11NO3 |
Molecular Weight |
277.274 |
PSA |
63.24000 |
Solubility |
Chloroform (Slightly), DMSO (Slightly), Ethyl Acetate (Slightly) |
Storage condition |
Refrigerator |
Vapour Pressure |
0.0±1.3 mmHg at 25°C |
Applications of N-(1,4-dioxonaphthalen-2-yl)benzamide
N-(1,4-dioxonaphthalen-2-yl)benzamide finds applications in various fields:
- Pharmaceuticals: Its potential anti-cancer and anti-inflammatory properties make it a candidate for drug development.
- Materials Science: The compound can be used in the synthesis of polymers or materials that require specific optical or electronic properties due to its aromatic structure.
- Analytical Chemistry: It may serve as a reagent or standard in analytical methods for detecting specific analytes.
Interaction Studies of N-(1,4-dioxonaphthalen-2-yl)benzamide
Interaction studies involving N-(1,4-dioxonaphthalen-2-yl)benzamide have focused on its binding affinity with biological targets such as enzymes and receptors. These studies often employ techniques like molecular docking and spectroscopy to elucidate binding mechanisms and affinities. The results indicate that the compound can effectively inhibit certain enzymes related to cancer progression, suggesting its potential therapeutic roles.
Biological Activity of N-(1,4-dioxonaphthalen-2-yl)benzamide
Research indicates that N-(1,4-dioxonaphthalen-2-yl)benzamide exhibits notable biological activities. It has been studied for its potential as an anti-cancer agent due to its ability to inhibit certain enzymes involved in tumor growth. Additionally, it may possess anti-inflammatory properties, making it a candidate for therapeutic applications in treating inflammatory diseases.
Physical sample testing spectrum (NMR) of N-(1,4-dioxonaphthalen-2-yl)benzamide
Cas:2348-81-4
Cas:98-88-4
Cas:130-15-4