N-(2-methoxyphenyl)-2,5-dimethylaniline
Names and Identifiers of N-(2-methoxyphenyl)-2,5-dimethylaniline
CAS Number |
211292-60-3 |
|---|---|
IUPAC Name |
N-(2-methoxyphenyl)-2,5-dimethylaniline |
InChI |
InChI=1S/C15H17NO/c1-11-8-9-12(2)14(10-11)16-13-6-4-5-7-15(13)17-3/h4-10,16H,1-3H3 |
InChIKey |
MSMWWVPVYSKCIM-UHFFFAOYSA-N |
Canonical SMILES |
CC1=CC(=C(C=C1)C)NC2=CC=CC=C2OC |
Physical and chemical properties of N-(2-methoxyphenyl)-2,5-dimethylaniline
Exact Mass |
227.13100 |
|---|---|
LogP |
4.12860 |
Molecular Formula |
C15H17NO |
Molecular Weight |
227.30200 |
PSA |
21.26000 |
Applications of N-(2-methoxyphenyl)-2,5-dimethylaniline
N-(2-methoxyphenyl)-2,5-dimethylaniline has various applications across different fields:
- Chemical Industry: It serves as an intermediate in the synthesis of dyes, pigments, and other organic compounds.
- Pharmaceuticals: Due to its potential biological activity, it is explored for use in drug development and medicinal applications.
- Research: It is utilized as a building block for synthesizing more complex organic molecules and studying reaction mechanisms.
Interaction Studies of N-(2-methoxyphenyl)-2,5-dimethylaniline
Studies on the interaction of N-(2-methoxyphenyl)-2,5-dimethylaniline with biological molecules are essential to understand its mechanism of action. Research has indicated that it may interact with specific enzymes or receptors in biological pathways, potentially leading to inhibition or modulation of these targets. Detailed interaction studies are crucial for elucidating its therapeutic potential and optimizing its efficacy.
Biological Activity of N-(2-methoxyphenyl)-2,5-dimethylaniline
Research indicates that N-(2-methoxyphenyl)-2,5-dimethylaniline exhibits potential biological activities. Preliminary studies suggest it may possess antimicrobial properties, making it a candidate for further investigation in medicinal chemistry. Its structure allows for interactions with biological targets, which could lead to therapeutic applications in treating infections or inflammatory conditions.