N-(5-amino-2-fluorophenyl)acetamide
Names and Identifiers of N-(5-amino-2-fluorophenyl)acetamide
CAS Number |
75001-47-7 |
|---|---|
MDL Number |
MFCD09049668 |
IUPAC Name |
N-(5-amino-2-fluorophenyl)acetamide |
InChI |
InChI=1S/C8H9FN2O/c1-5(12)11-8-4-6(10)2-3-7(8)9/h2-4H,10H2,1H3,(H,11,12) |
InChIKey |
IKJGIOJFOJSYLD-UHFFFAOYSA-N |
Canonical SMILES |
CC(=O)NC1=C(C=CC(=C1)N)F |
UNSPSC Code |
12352100 |
Physical and chemical properties of N-(5-amino-2-fluorophenyl)acetamide
Boiling Point |
375.9±32.0 °C(Predicted) |
|---|---|
Exact Mass |
168.07000 |
LogP |
2.02050 |
Molecular Formula |
C8H9FN2O |
Molecular Weight |
168.16800 |
PSA |
55.12000 |
Storage condition |
2-8°C(protect from light) |
Safety Information of N-(5-amino-2-fluorophenyl)acetamide
Applications of N-(5-amino-2-fluorophenyl)acetamide
N-(5-amino-2-fluorophenyl)acetamide has several potential applications:
- Pharmaceutical Development: Due to its biological activity, it may serve as a lead compound in drug discovery programs targeting various diseases.
- Chemical Research: It can be utilized in studies related to chemical reactivity and synthesis methodologies.
- Agricultural Chemistry: Similar compounds are often investigated for their herbicidal or pesticidal properties.
Its unique structure allows researchers to explore modifications that could enhance its efficacy or reduce side effects in therapeutic applications.
Interaction Studies of N-(5-amino-2-fluorophenyl)acetamide
Studies on N-(5-amino-2-fluorophenyl)acetamide's interactions with biological systems are essential for understanding its pharmacological profile. Interaction studies typically focus on:
- Binding Affinity: Assessing how well the compound binds to specific receptors or enzymes.
- Mechanism of Action: Investigating how the compound influences biological pathways at the molecular level.
- Toxicity Profiles: Evaluating any potential toxic effects in vitro and in vivo.
These studies are crucial for determining the viability of N-(5-amino-2-fluorophenyl)acetamide as a therapeutic agent.
Biological Activity of N-(5-amino-2-fluorophenyl)acetamide
N-(5-amino-2-fluorophenyl)acetamide exhibits significant biological activity, particularly in the field of medicinal chemistry. Its structure allows it to interact with various biological targets, including enzymes and receptors. The presence of both the amino and fluorine groups enhances its binding affinity and specificity towards these targets, making it a candidate for drug development. Research indicates that compounds with similar structures often exhibit anti-inflammatory and analgesic properties, suggesting potential therapeutic applications.
