N-aminopyridazinium hexafluorophosphate
CAS No.:
346412-97-3
M. Wt:
-
M. Fa:
C4H6F6N3P
InChI Key:
YLIHKLPWUYQMCV-UHFFFAOYSA-N
Names and Identifiers of N-aminopyridazinium hexafluorophosphate
CAS Number |
346412-97-3 |
|---|---|
IUPAC Name |
pyridazin-1-ium-1-amine;hexafluorophosphate |
InChI |
InChI=1S/C4H6N3.F6P/c5-7-4-2-1-3-6-7;1-7(2,3,4,5)6/h1-4H,(H2,5,6);/q+1;-1 |
InChIKey |
YLIHKLPWUYQMCV-UHFFFAOYSA-N |
Canonical SMILES |
C1=CC=[N+](N=C1)N.F[P-](F)(F)(F)(F)F |
Physical and chemical properties of N-aminopyridazinium hexafluorophosphate
Molecular Formula |
C4H6F6N3P |
|---|
Applications of N-aminopyridazinium hexafluorophosphate
N-aminopyridazinium hexafluorophosphate has potential applications in various fields:
- Organic Synthesis: It serves as a useful reagent in organic synthesis for constructing complex molecular architectures due to its ability to participate in nucleophilic and electrophilic reactions.
- Ionic Liquids: The compound can be utilized in the formulation of ionic liquids, which are gaining attention for their unique properties such as low volatility and high thermal stability.
- Material Science: Its unique structural properties may also find applications in developing new materials with specific electronic or optical characteristics.
Interaction Studies of N-aminopyridazinium hexafluorophosphate
Interaction studies involving N-aminopyridazinium hexafluorophosphate primarily focus on its behavior in solution and reactivity with other chemical entities. The presence of the hexafluorophosphate anion allows for investigations into solvation effects and ionic interactions, particularly in ionic liquid systems where it may exhibit different solubility profiles compared to other salts. Additionally, studies on its interaction with biological molecules could reveal insights into potential therapeutic applications.