N-methylquinolin-5-amine
Names and Identifiers of N-methylquinolin-5-amine
CAS Number |
7506-67-4 |
|---|---|
EC Number |
850-987-4 |
IUPAC Name |
N-methylquinolin-5-amine |
InChI |
InChI=1S/C10H10N2/c1-11-9-5-2-6-10-8(9)4-3-7-12-10/h2-7,11H,1H3 |
InChIKey |
BDLNGDAQWHSFBU-UHFFFAOYSA-N |
Canonical SMILES |
CNC1=CC=CC2=C1C=CC=N2 |
Physical and chemical properties of N-methylquinolin-5-amine
Boiling Point |
306.7ºC at 760mmHg |
|---|---|
Density |
1.161g/cm3 |
Exact Mass |
158.08400 |
Flash Point |
139.3ºC |
Index of Refraction |
1.685 |
LogP |
2.34950 |
Molecular Formula |
C10H10N2 |
Molecular Weight |
158.20000 |
PSA |
24.92000 |
Safety Information of N-methylquinolin-5-amine
Applications of N-methylquinolin-5-amine
N-methylquinolin-5-amine finds applications in various fields:
- Pharmaceuticals: Due to its biological activity, it is investigated for potential therapeutic uses, particularly in developing new antimicrobial and anticancer drugs.
- Chemical Synthesis: It serves as an intermediate in synthesizing more complex organic molecules, including dyes and agrochemicals.
- Research: It is utilized in studies focusing on enzyme interactions and biochemical pathways due to its ability to bind specific targets within biological systems.
Interaction Studies of N-methylquinolin-5-amine
Studies have shown that N-methylquinolin-5-amine interacts with various enzymes and proteins, influencing their activity. These interactions can lead to significant changes in metabolic pathways, making it a valuable compound for understanding biological mechanisms and developing new therapeutic agents.
Biological Activity of N-methylquinolin-5-amine
N-methylquinolin-5-amine has garnered interest due to its potential biological activities. Research suggests that it may possess antimicrobial and anticancer properties, making it a candidate for further investigation in medicinal chemistry. The mechanism of action often involves interaction with specific molecular targets, potentially inhibiting key enzymes or signaling pathways involved in disease processes.
Physical sample testing spectrum (NMR) of N-methylquinolin-5-amine
