Perfluorocyclohexanecarbonitrile
CAS No.:
51579-56-7
M. Wt:
307.06400
M. Fa:
C7F11N
InChI Key:
-
Names and Identifiers of Perfluorocyclohexanecarbonitrile
CAS Number |
51579-56-7 |
|---|---|
IUPAC Name |
1,2,2,3,3,4,4,5,5,6,6-undecakis(fluoranyl)cyclohexane-1-carbonitrile |
Canonical SMILES |
C(#N)C1(C(C(C(C(C1(F)F)(F)F)(F)F)(F)F)(F)F)F |
Physical and chemical properties of Perfluorocyclohexanecarbonitrile
Boiling Point |
144.9ºC at 760 mmHg |
|---|---|
Density |
1.71g/cm3 |
Exact Mass |
306.98600 |
Flash Point |
41.5ºC |
Index of Refraction |
1.302 |
LogP |
3.40838 |
Molecular Formula |
C7F11N |
Molecular Weight |
307.06400 |
PSA |
23.79000 |
Applications of Perfluorocyclohexanecarbonitrile
Perfluorocyclohexanecarbonitrile has several applications:
- Solvent in Organic Chemistry: Due to its unique solvent properties, it is used in reactions requiring non-polar solvents.
- Fluorinated Building Block: It serves as a precursor for synthesizing more complex fluorinated compounds used in pharmaceuticals and agrochemicals.
- Research Tool: Its distinctive properties make it valuable in studies related to fluorine chemistry and materials science.
Interaction Studies of Perfluorocyclohexanecarbonitrile
Interaction studies involving perfluorocyclohexanecarbonitrile focus on its behavior in various chemical environments. These studies often explore:
- Solubility Profiles: Understanding how this compound interacts with different solvents and solutes can provide insights into its utility in synthesis.
- Reactivity with Biological Molecules: Investigating how it interacts with proteins or nucleic acids can reveal potential therapeutic applications.
Such studies are essential for assessing the compound's safety and efficacy in practical applications.
Similar CompoundsSeveral compounds share structural similarities with perfluorocyclohexanecarbonitrile, highlighting its uniqueness:
| Compound Name | Molecular Formula | Key Features |
|---|---|---|
| Perfluoromethylcyclohexane | Fully fluorinated structure; used as solvent | |
| Perfluoroethylcyclopropane | Smaller ring; high stability | |
| Hexafluorocyclopentene | Unsaturated; reactive due to double bond | |
| Trifluoromethylcyclopropane | Contains trifluoromethyl group; versatile |
Cas:90408-45-0
Cas:773-82-0
Cas:623-26-7