Phthalazin-5-ol
CAS No.:
1309379-51-8
M. Wt:
146.15
M. Fa:
C8H6N2O
InChI Key:
FJXUDJZWIPEMKR-UHFFFAOYSA-N
Names and Identifiers of Phthalazin-5-ol
CAS Number |
1309379-51-8 |
|---|---|
IUPAC Name |
phthalazin-5-ol |
InChI |
InChI=1S/C8H6N2O/c11-8-3-1-2-6-4-9-10-5-7(6)8/h1-5,11H |
InChIKey |
FJXUDJZWIPEMKR-UHFFFAOYSA-N |
Canonical SMILES |
C1=CC2=CN=NC=C2C(=C1)O |
Physical and chemical properties of Phthalazin-5-ol
Molecular Formula |
C8H6N2O |
|---|---|
Molecular Weight |
146.15 |
Applications of Phthalazin-5-ol
Phthalazin-5-ol has several notable applications:
- Pharmaceutical Development: Its derivatives are being explored as potential drugs for treating cancer and other diseases due to their biological activity.
- Chemical Intermediates: Phthalazin-5-ol serves as an intermediate in the synthesis of more complex organic molecules used in various chemical industries.
- Research Tool: The compound is utilized in biochemical research to study enzyme interactions and cellular processes.
Interaction Studies of Phthalazin-5-ol
Studies on phthalazin-5-ol's interactions reveal its potential in drug design:
- Molecular Docking Studies: These studies have shown that phthalazin derivatives can bind effectively to target proteins involved in cancer progression, indicating their potential as lead compounds for drug development.
- In Vivo Studies: Research has demonstrated promising results in animal models where phthalazine derivatives exhibit anticancer effects, leading to further investigation into their mechanisms of action and therapeutic efficacy.
Biological Activity of Phthalazin-5-ol
Phthalazin-5-ol and its derivatives have garnered interest for their biological activities. Research indicates that these compounds may possess:
- Anticancer Properties: Some derivatives have shown significant activity against various cancer cell lines, potentially through mechanisms involving inhibition of specific cellular pathways such as vascular endothelial growth factor receptor 2 (VEGFR-2) signaling.
- Antimicrobial Activity: Certain phthalazine derivatives demonstrate antimicrobial effects against a range of pathogens, indicating their potential use in developing new antibiotics.
- Enzyme Inhibition: Phthalazin-5-ol has been studied for its ability to inhibit specific enzymes, which may contribute to its therapeutic effects in various diseases.