Propyl 2-amino-5-bromobenzoate
CAS No.:
1178634-57-5
M. Wt:
258.11
M. Fa:
C10H12BrNO2
InChI Key:
RZNWHBKKKOQGIW-UHFFFAOYSA-N
Names and Identifiers of Propyl 2-amino-5-bromobenzoate
CAS Number |
1178634-57-5 |
|---|---|
IUPAC Name |
propyl 2-amino-5-bromobenzoate |
InChI |
InChI=1S/C10H12BrNO2/c1-2-5-14-10(13)8-6-7(11)3-4-9(8)12/h3-4,6H,2,5,12H2,1H3 |
InChIKey |
RZNWHBKKKOQGIW-UHFFFAOYSA-N |
Canonical SMILES |
CCCOC(=O)C1=C(C=CC(=C1)Br)N |
Physical and chemical properties of Propyl 2-amino-5-bromobenzoate
Acidity coefficient |
1.70±0.10(Predicted) |
|---|---|
Boiling Point |
316.2±22.0 °C(Predicted) |
Density |
1.443±0.06 g/cm3(Predicted) |
Molecular Formula |
C10H12BrNO2 |
Molecular Weight |
258.11 |
Applications of Propyl 2-amino-5-bromobenzoate
Propyl 2-amino-5-bromobenzoate finds applications in several fields:
- Medicinal Chemistry: As a precursor for synthesizing antiviral agents and other pharmaceuticals.
- Agriculture: Utilized as a plant growth regulator to enhance crop yields.
- Analytical Chemistry: Employed in the detection and quantification of metal ions like cobalt and nickel.
Interaction Studies of Propyl 2-amino-5-bromobenzoate
Studies on Propyl 2-amino-5-bromobenzoate have shown interactions with various biological targets. Its ability to inhibit specific enzymes makes it a candidate for further research into therapeutic applications. Interaction studies are crucial for understanding its efficacy and safety profile in medicinal contexts.
Biological Activity of Propyl 2-amino-5-bromobenzoate
Propyl 2-amino-5-bromobenzoate exhibits notable biological activities. It has been studied for its potential as an inhibitor against various pathogens, including its role in targeting hepatitis C virus NS5b RNA polymerase. Additionally, it has demonstrated plant growth-regulating properties, making it useful in agricultural applications.