Sarcolysin hydrochloride
CAS No.:
1465-26-5
M. Wt:
341.66100
M. Fa:
C13H19Cl3N2O2
InChI Key:
OUUYBRCCFUEMLH-UHFFFAOYSA-N
Names and Identifiers of Sarcolysin hydrochloride
CAS Number |
1465-26-5 |
|---|---|
IUPAC Name |
2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoic acid;hydrochloride |
InChI |
InChI=1S/C13H18Cl2N2O2.ClH/c14-5-7-17(8-6-15)11-3-1-10(2-4-11)9-12(16)13(18)19;/h1-4,12H,5-9,16H2,(H,18,19);1H |
InChIKey |
OUUYBRCCFUEMLH-UHFFFAOYSA-N |
Canonical SMILES |
C1=CC(=CC=C1CC(C(=O)O)N)N(CCCl)CCCl.Cl |
UNII |
GEG3Q4FC64 |
Physical and chemical properties of Sarcolysin hydrochloride
Exact Mass |
340.05100 |
|---|---|
LogP |
3.42730 |
Molecular Formula |
C13H19Cl3N2O2 |
Molecular Weight |
341.66100 |
PSA |
66.56000 |
Applications of Sarcolysin hydrochloride
Sarcolysin hydrochloride is primarily used in oncology for:
- Chemotherapy: It is employed in treating multiple myeloma and melanoma due to its potent cytotoxic effects on cancer cells.
- Combination Therapies: Sarcolysin is often used alongside other chemotherapeutic agents to enhance therapeutic efficacy and overcome drug resistance.
- Research: It serves as a model compound in studies investigating DNA damage and repair mechanisms.
Interaction Studies of Sarcolysin hydrochloride
Interaction studies involving Sarcolysin hydrochloride have revealed its potential interactions with various biological molecules:
- Protein Binding: Sarcolysin exhibits significant binding to plasma proteins, which can influence its pharmacokinetics and dynamics. Approximately 50% to 90% of the drug binds to serum albumin and alpha-1 acid glycoprotein.
- Metabolic Pathways: The drug's metabolism primarily involves hydrolysis via enzymes such as carboxylesterases, leading to the formation of less active metabolites that are subsequently eliminated from the body.
Biological Activity of Sarcolysin hydrochloride
Sarcolysin hydrochloride exhibits significant biological activity as an antineoplastic agent. Its primary actions include:
- Cytotoxicity: The compound effectively induces apoptosis in cancer cells by disrupting their DNA integrity.
- Immunomodulation: Sarcolysin has been noted to have immunotherapeutic properties, enhancing the immune response against tumor cells.
- Selectivity for Tumor Cells: While it affects rapidly dividing cells, Sarcolysin shows a degree of selectivity towards malignant cells compared to normal cells, which is critical for minimizing side effects during cancer treatment.