Tert-butyl N-(7H-purin-6-yl)carbamate
Names and Identifiers of Tert-butyl N-(7H-purin-6-yl)carbamate
CAS Number |
309947-88-4 |
|---|---|
IUPAC Name |
tert-butyl N-(7H-purin-6-yl)carbamate |
InChI |
InChI=1S/C10H13N5O2/c1-10(2,3)17-9(16)15-8-6-7(12-4-11-6)13-5-14-8/h4-5H,1-3H3,(H2,11,12,13,14,15,16) |
InChIKey |
IXLGPDYAOBHJFO-UHFFFAOYSA-N |
Canonical SMILES |
CC(C)(C)OC(=O)NC1=NC=NC2=C1NC=N2 |
Physical and chemical properties of Tert-butyl N-(7H-purin-6-yl)carbamate
Exact Mass |
235.10700 |
|---|---|
LogP |
1.71350 |
Molecular Formula |
C10H13N5O2 |
Molecular Weight |
235.24300 |
PSA |
96.28000 |
Applications of Tert-butyl N-(7H-purin-6-yl)carbamate
Tert-butyl N-(7H-purin-6-yl)carbamate has several notable applications:
- Organic Synthesis: It serves as an intermediate in the synthesis of more complex organic molecules, particularly in medicinal chemistry.
- Biological Research: The compound can be utilized to study the biological activity of purine derivatives and their interactions with various enzymes and receptors.
- Pharmaceutical Development: It acts as a building block for developing potential therapeutic agents targeting diseases related to purine metabolism.
Interaction Studies of Tert-butyl N-(7H-purin-6-yl)carbamate
Interaction studies involving tert-butyl N-(7H-purin-6-yl)carbamate could focus on its binding affinity to specific enzymes involved in purine metabolism or its effect on nucleic acid structures. Such studies are crucial for understanding its potential therapeutic effects and mechanisms of action in biological systems.
Biological Activity of Tert-butyl N-(7H-purin-6-yl)carbamate
The biological activity of tert-butyl N-(7H-purin-6-yl)carbamate is primarily linked to its interaction with purine metabolism pathways. It may act as a substrate or inhibitor for enzymes involved in these pathways, influencing cellular processes such as DNA and RNA synthesis. Additionally, compounds with similar structures have shown potential antiviral and anticancer activities, suggesting that this compound could possess similar therapeutic properties.
Cas:309947-86-2
Cas:24424-99-5
Cas:73-24-5