Triethyl(phenyl)stannane
CAS No.:
878-51-3
M. Wt:
282.98800
M. Fa:
C12H20Sn
InChI Key:
CKGABOFCIIXWCH-UHFFFAOYSA-N
Names and Identifiers of Triethyl(phenyl)stannane
CAS Number |
878-51-3 |
|---|---|
IUPAC Name |
triethyl(phenyl)stannane |
InChI |
InChI=1S/C6H5.3C2H5.Sn/c1-2-4-6-5-3-1;3*1-2;/h1-5H;3*1H2,2H3; |
InChIKey |
CKGABOFCIIXWCH-UHFFFAOYSA-N |
Canonical SMILES |
CC[Sn](CC)(CC)C1=CC=CC=C1 |
Physical and chemical properties of Triethyl(phenyl)stannane
Exact Mass |
284.05900 |
|---|---|
LogP |
3.40210 |
Molecular Formula |
C12H20Sn |
Molecular Weight |
282.98800 |
Applications of Triethyl(phenyl)stannane
Triethyl(phenyl)stannane finds applications across various fields:
- Organic Synthesis: It is used as a reagent in organic synthesis for coupling reactions and as a stannylating agent.
- Materials Science: Its unique properties make it suitable for developing new materials with specific characteristics.
- Catalysis: The compound can serve as a catalyst or catalyst precursor in various
Interaction Studies of Triethyl(phenyl)stannane
Interaction studies involving triethyl(phenyl)stannane focus on its reactivity with different substrates and biological molecules. Research indicates that it can act as a carbometallating agent, facilitating the transfer of organic groups during chemical transformations. Additionally, studies have shown that it interacts with palladium complexes, leading to selective transfer reactions that are valuable in synthetic organic chemistry.
Cas:30295-76-2