Trimethyl((4-nitrophenyl)ethynyl)silane
Names and Identifiers of Trimethyl((4-nitrophenyl)ethynyl)silane
CAS Number |
75867-38-8 |
|---|---|
MDL Number |
MFCD00555128 |
IUPAC Name |
trimethyl-[2-(4-nitrophenyl)ethynyl]silane |
InChI |
InChI=1S/C11H13NO2Si/c1-15(2,3)9-8-10-4-6-11(7-5-10)12(13)14/h4-7H,1-3H3 |
InChIKey |
YVPIXZAXKQWEOB-UHFFFAOYSA-N |
Canonical SMILES |
C[Si](C)(C)C#CC1=CC=C(C=C1)[N+](=O)[O-] |
UNSPSC Code |
12352100 |
Physical and chemical properties of Trimethyl((4-nitrophenyl)ethynyl)silane
Exact Mass |
219.07200 |
|---|---|
H Bond Acceptors |
2 |
H Bond Donors |
0 |
LogP |
3.34690 |
Molecular Formula |
C11H13NO2Si |
Molecular Weight |
219.31200 |
PSA |
45.82000 |
Storage condition |
2-8°C |
Safety Information of Trimethyl((4-nitrophenyl)ethynyl)silane
Applications of Trimethyl((4-nitrophenyl)ethynyl)silane
Trimethyl((4-nitrophenyl)ethynyl)silane finds applications in various fields:
- Organic Synthesis: It serves as a versatile building block for synthesizing more complex organic molecules.
- Materials Science: Due to its silane component, it can be used in the development of silicone-based materials.
- Pharmaceuticals: Its potential biological activity makes it an interesting candidate for drug development.
The compound's unique structure allows it to participate in diverse chemical transformations, making it valuable in both academic research and industrial applications.
Interaction Studies of Trimethyl((4-nitrophenyl)ethynyl)silane
Interaction studies involving trimethyl((4-nitrophenyl)ethynyl)silane focus on its reactivity profile with various nucleophiles and electrophiles. These studies help elucidate its potential as a reactive intermediate in organic synthesis. Additionally, understanding its interactions with biological systems could pave the way for developing novel therapeutic agents or diagnostic tools.
While specific interaction studies are sparse, the compound's reactivity suggests that it could engage in significant interactions with biological macromolecules, warranting further research into its pharmacological properties.
Physical sample testing spectrum (NMR) of Trimethyl((4-nitrophenyl)ethynyl)silane
