Yibeissine
Names and Identifiers of Yibeissine
CAS Number |
143502-51-6 |
|---|---|
IUPAC Name |
(3S,3'R,3'aS,4aS,6'S,6aS,6bS,7'aR,9R,11R,11aS,11bR)-3,11-dihydroxy-3',6',10,11b-tetramethylspiro[1,2,3,4,4a,6,6a,6b,7,8,11,11a-dodecahydrobenzo[a]fluorene-9,2'-3a,4,5,6,7,7a-hexahydro-3H-furo[3,2-b]pyridine]-5-one |
InChI |
InChI=1S/C27H41NO4/c1-13-9-21-24(28-12-13)15(3)27(32-21)8-6-17-18-11-20(30)19-10-16(29)5-7-26(19,4)23(18)25(31)22(17)14(27)2/h13,15-19,21,23-25,28-29,31H,5-12H2,1-4H3/t13-,15+,16-,17-,18-,19+,21+,23+,24-,25-,26-,27-/m0/s1 |
InChIKey |
NURPXYQPDMVKOY-RUKZUWONSA-N |
Canonical SMILES |
CC1CC2C(C(C3(O2)CCC4C5CC(=O)C6CC(CCC6(C5C(C4=C3C)O)C)O)C)NC1 |
Isomeric SMILES |
C[C@H]1C[C@@H]2[C@H]([C@H]([C@]3(O2)CC[C@H]4[C@@H]5CC(=O)[C@H]6C[C@H](CC[C@@]6([C@H]5[C@H](C4=C3C)O)C)O)C)NC1 |
Physical and chemical properties of Yibeissine
Acidity coefficient |
14.44±0.70(Predicted) |
|---|---|
Boiling Point |
611.6ºC at 760mmHg |
Density |
1.22g/cm3 |
Exact Mass |
443.30400 |
Flash Point |
323.7ºC |
Index of Refraction |
1.59 |
LogP |
3.56040 |
Molecular Formula |
C27H41NO4 |
Molecular Weight |
443.61900 |
PSA |
78.79000 |
Storage condition |
2-8℃ |
Vapour Pressure |
1.64E-17mmHg at 25°C |
Applications of Yibeissine
Yibeissine is primarily used in traditional medicine for treating respiratory ailments such as cough and bronchitis. Its anti-cancer properties are being explored for potential therapeutic applications in oncology. Furthermore, it may be incorporated into functional foods and dietary supplements due to its health benefits.
Interaction Studies of Yibeissine
Research on Yibeissine has indicated interactions with various biological targets, including enzymes and receptors involved in cancer progression and inflammation. Interaction studies have revealed that Yibeissine can modulate signaling pathways related to cell survival and apoptosis, contributing to its anti-cancer effects. Additionally, studies have shown its potential to enhance the efficacy of other therapeutic agents when used in combination therapies.
Biological Activity of Yibeissine
Yibeissine exhibits significant biological activities, making it a subject of interest in pharmacological research. Studies have demonstrated its potential as an anti-cancer agent, particularly against non-small cell lung cancer. It functions through mechanisms such as inducing apoptosis in cancer cells and inhibiting tumor growth. Additionally, Yibeissine has shown anti-inflammatory properties and is used in treating respiratory conditions due to its ability to alleviate cough and phlegm production.