Zeorin
Names and Identifiers of Zeorin
CAS Number |
22570-53-2 |
|---|---|
IUPAC Name |
(3S,3aS,5aR,5bR,7S,7aS,11aR,11bR,13aR,13bS)-3-(2-hydroxypropan-2-yl)-5a,5b,8,8,11a,13b-hexamethyl-1,2,3,3a,4,5,6,7,7a,9,10,11,11b,12,13,13a-hexadecahydrocyclopenta[a]chrysen-7-ol |
InChI |
InChI=1S/C30H52O2/c1-25(2)14-9-15-28(6)23-11-10-22-27(5)16-12-19(26(3,4)32)20(27)13-17-29(22,7)30(23,8)18-21(31)24(25)28/h19-24,31-32H,9-18H2,1-8H3/t19-,20-,21-,22+,23+,24-,27-,28+,29+,30+/m0/s1 |
InChIKey |
KYBLAIAGFNCVHL-PMVHANJISA-N |
Canonical SMILES |
CC1(CCCC2(C1C(CC3(C2CCC4C3(CCC5C4(CCC5C(C)(C)O)C)C)C)O)C)C |
Isomeric SMILES |
C[C@]12CC[C@@H]([C@@H]1CC[C@@]3([C@@H]2CC[C@H]4[C@]3(C[C@@H]([C@@H]5[C@@]4(CCCC5(C)C)C)O)C)C)C(C)(C)O |
Physical and chemical properties of Zeorin
Acidity coefficient |
14.98±0.70(Predicted) |
|---|---|
Boiling Point |
515.6±23.0 °C at 760 mmHg |
Density |
1.0±0.1 g/cm3 |
Exact Mass |
444.396729 |
Flash Point |
206.4±17.2 °C |
Index of Refraction |
1.521 |
LogP |
9.10 |
Melting Point |
253 °C |
Molecular Formula |
C30H52O2 |
Molecular Weight |
444.733 |
PSA |
40.46000 |
Vapour Pressure |
0.0±3.0 mmHg at 25°C |
Applications of Zeorin
Zeorin's unique biological properties lend it to various applications:
- Pharmaceuticals: Due to its antimicrobial activity, it could be developed into new antibiotics or antifungal agents.
- Allergy Treatments: Its ability to inhibit histamine release suggests potential use in managing allergic reactions.
- Natural Products Research: As a compound derived from fungi and lichens, Zeorin may be of interest in studies related to natural product chemistry and bioprospecting for new drugs.
Interaction Studies of Zeorin
Interaction studies involving Zeorin have primarily focused on its effects on biological systems rather than direct interactions with other compounds. Its inhibition of histamine release indicates possible interactions with mast cell signaling pathways. Further research is warranted to explore its interactions with other pharmaceuticals or natural compounds, which could enhance its efficacy or reveal synergistic effects.
Biological Activity of Zeorin
Zeorin exhibits notable biological activities, particularly its antimicrobial properties. It demonstrates strong inhibition against bacteria and fungi, making it a candidate for use in treating infections caused by these pathogens. Additionally, Zeorin significantly inhibits histamine release from mast cells induced by DNP24-BSA, achieving up to a 40% reduction in histamine release. These properties suggest potential therapeutic applications in allergy treatments and antimicrobial therapies.