n-(4-Cyanophenyl)-2-methylpropanamide
Names and Identifiers of n-(4-Cyanophenyl)-2-methylpropanamide
CAS Number |
113715-23-4 |
|---|---|
MDL Number |
MFCD09040418 |
IUPAC Name |
N-(4-cyanophenyl)-2-methylpropanamide |
InChI |
InChI=1S/C11H12N2O/c1-8(2)11(14)13-10-5-3-9(7-12)4-6-10/h3-6,8H,1-2H3,(H,13,14) |
InChIKey |
WQZFOMXBTXLFNS-UHFFFAOYSA-N |
Canonical SMILES |
CC(C)C(=O)NC1=CC=C(C#N)C=C1 |
UNSPSC Code |
12352100 |
Physical and chemical properties of n-(4-Cyanophenyl)-2-methylpropanamide
Exact Mass |
188.09500 |
|---|---|
H Bond Acceptors |
2 |
H Bond Donors |
1 |
LogP |
2.22578 |
Molecular Formula |
C11H12N2O |
Molecular Weight |
188.22600 |
PSA |
52.89000 |
Safety Information of n-(4-Cyanophenyl)-2-methylpropanamide
Applications of n-(4-Cyanophenyl)-2-methylpropanamide
N-(4-cyanophenyl)-2-methylpropanamide finds applications in various fields:
- Pharmaceuticals: It is investigated for its potential use in developing anti-inflammatory and analgesic drugs.
- Chemical Research: The compound serves as a building block for synthesizing more complex organic molecules.
- Material Science: Its unique properties may be explored in the development of new materials with specific functionalities.
Interaction Studies of n-(4-Cyanophenyl)-2-methylpropanamide
Interaction studies involving N-(4-cyanophenyl)-2-methylpropanamide focus on its binding affinity to various biological targets. Preliminary studies suggest that it may interact with certain receptors involved in pain and inflammation pathways, although detailed mechanisms are still under investigation.
Biological Activity of n-(4-Cyanophenyl)-2-methylpropanamide
Research indicates that N-(4-cyanophenyl)-2-methylpropanamide exhibits significant biological activity, particularly in pharmacological contexts. It has been studied for its potential anti-inflammatory and analgesic properties. The presence of the cyanophenyl group may enhance its interaction with biological targets, making it a candidate for further investigation in drug development.
