n-Benzyl-2-(methylamino)acetamide
Names and Identifiers of n-Benzyl-2-(methylamino)acetamide
CAS Number |
74963-37-4 |
|---|---|
MDL Number |
MFCD02266689 |
IUPAC Name |
N-benzyl-2-(methylamino)acetamide |
InChI |
InChI=1S/C10H14N2O/c1-11-8-10(13)12-7-9-5-3-2-4-6-9/h2-6,11H,7-8H2,1H3,(H,12,13) |
InChIKey |
XJMFSXXPSYKZHK-UHFFFAOYSA-N |
Canonical SMILES |
CNCC(=O)NCC1=CC=CC=C1 |
UNSPSC Code |
12352100 |
Physical and chemical properties of n-Benzyl-2-(methylamino)acetamide
H Bond Acceptors |
2 |
|---|---|
H Bond Donors |
2 |
LogP |
0.426311406 |
Molecular Formula |
C10H14N2O |
Molecular Weight |
178.2350006 |
Safety Information of n-Benzyl-2-(methylamino)acetamide
Applications of n-Benzyl-2-(methylamino)acetamide
N-benzyl-2-(methylamino)acetamide has diverse applications across various fields:
- Chemistry: It serves as a building block in the synthesis of more complex organic molecules.
- Biology: The compound is used in studies related to enzyme-substrate interactions and biochemical assays.
- Medicine: Investigated for potential therapeutic properties, including analgesic and anti-inflammatory effects.
- Industry: Employed in the production of specialty chemicals and agrochemicals.
Interaction Studies of n-Benzyl-2-(methylamino)acetamide
The mechanism of action for N-benzyl-2-(methylamino)acetamide involves its binding to specific enzymes or receptors, altering their activity. The precise pathways depend on the biological context and application being studied. Research into this compound's interactions continues to reveal insights into its potential therapeutic benefits and mechanisms.
Similar CompoundsSeveral compounds are similar to N-benzyl-2-(methylamino)acetamide, each differing in structure and properties:
- N-benzylacetamide: Lacks the methylamino group, limiting its versatility in certain reactions.
- N-methylacetamide: Lacks the benzyl group, affecting its binding affinity and reactivity.
- N-benzyl-N-methylacetamide: Similar structure but different functional groups lead to variations in chemical behavior and applications.
N-benzyl-2-(methylamino)acetamide is distinguished by its dual functional groups (benzyl and methylamino), which provide a broader range of chemical reactivity and applications compared to similar compounds. This unique structure enhances its utility in both synthetic chemistry and biological research.
Biological Activity of n-Benzyl-2-(methylamino)acetamide
N-benzyl-2-(methylamino)acetamide has been investigated for its biological activity, particularly in the context of enzyme inhibition and receptor binding. The compound's structure allows it to interact with specific molecular targets, potentially acting as an inhibitor or activator of certain enzymes. This interaction is influenced by the presence of both the benzyl and methylamino groups, which enhance its binding affinity to active sites of enzymes.
