tert-butyl 2-nitropyridin-4-ylcarbaMate
Names and Identifiers of tert-butyl 2-nitropyridin-4-ylcarbaMate
CAS Number |
1152428-55-1 |
|---|---|
IUPAC Name |
tert-butyl N-(2-nitropyridin-4-yl)carbamate |
Canonical SMILES |
CC(C)(C)OC(=O)NC1=CC(=NC=C1)[N+](=O)[O-] |
Physical and chemical properties of tert-butyl 2-nitropyridin-4-ylcarbaMate
Exact Mass |
239.09100 |
|---|---|
LogP |
2.87360 |
Molecular Formula |
C10H13N3O4 |
Molecular Weight |
239.22800 |
PSA |
100.53000 |
Applications of tert-butyl 2-nitropyridin-4-ylcarbaMate
Tert-Butyl (2-nitropyridin-4-yl)carbamate finds applications across several domains:
- Chemistry: Utilized as a protecting group for amines during peptide synthesis.
- Biology: Investigated for its potential as a biochemical probe.
- Medicine: Explored for therapeutic applications in drug development.
- Industry: Employed in the synthesis of various organic compounds .
Interaction Studies of tert-butyl 2-nitropyridin-4-ylcarbaMate
The interaction studies surrounding tert-Butyl (2-nitropyridin-4-yl)carbamate focus on its mechanism of action, which involves its role as a protecting group for amines. This functionality prevents unwanted reactions during synthetic processes. Furthermore, the compound's nitro group can undergo reduction to form an amino group, facilitating further chemical transformations .
Biological Activity of tert-butyl 2-nitropyridin-4-ylcarbaMate
Research indicates that tert-Butyl (2-nitropyridin-4-yl)carbamate may possess significant biological activity, particularly as a biochemical probe. Its ability to interact with specific molecular targets makes it valuable in exploring therapeutic potentials. Additionally, it has been investigated for its role in drug development, although detailed studies on its pharmacological effects are still ongoing .